About 2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine
2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine (PubChem CID 154686821) has the molecular formula C8H4Cl2IN3
and a molecular weight of 339.95 g/mol. Its IUPAC name is 2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine |
| PubChem CID | 154686821 |
| Molecular Formula | C8H4Cl2IN3 |
| Molecular Weight | 339.95 g/mol |
| Exact Mass | 338.88 |
| IUPAC Name | 2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine |
| SMILES | Clc1cc(CI)c2nc(Cl)ncc2n1 |
| InChI | InChI=1S/C8H4Cl2IN3/c9-6-1-4(2-11)7-5(13-6)3-12-8(10)14-7/h1,3H,2H2 |
| InChIKey | JJTDXJHQUXVRIJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.95 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine?
The IUPAC name of 2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine (CID 154686821) is 2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine.
What is the SMILES notation for 2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine?
The canonical SMILES for 2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine is Clc1cc(CI)c2nc(Cl)ncc2n1.
What is the InChIKey of 2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine?
The InChIKey is JJTDXJHQUXVRIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl2IN3/c9-6-1-4(2-11)7-5(13-6)3-12-8(10)14-7/h1,3H,2H2.
What are the key properties of 2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine?
2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine has a molecular weight of 339.95 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-8-(iodomethyl)pyrido[3,2-d]pyrimidine is sourced from PubChem (CID 154686821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).