C24H27F5N6O — CID 154687033
1,1,1-trifluoro-3-[2-fluoro-4-[2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-8-propan-2-ylpyrido[3,2-d]pyrimidin-6-yl]anilino]propan-2-ol (PubChem CID 154687033) has the molecular formula C24H27F5N6O and a molecular weight of 510.51 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[2-fluoro-4-[2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-8-propan-2-ylpyrido[3,2-d]pyrimidin-6-yl]anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[2-fluoro-4-[2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-8-propan-2-ylpyrido[3,2-d]pyrimidin-6-yl]anilino]propan-2-ol |
|---|---|
| PubChem CID | 154687033 |
| Molecular Formula | C24H27F5N6O |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 1,1,1-trifluoro-3-[2-fluoro-4-[2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-8-propan-2-ylpyrido[3,2-d]pyrimidin-6-yl]anilino]propan-2-ol |
| SMILES | CC(C)c1cc(-c2ccc(NCC(O)C(F)(F)F)c(F)c2)nc2cnc(N[C@@H]3CNC[C@@H](F)C3)nc12 |
| InChI | InChI=1S/C24H27F5N6O/c1-12(2)16-7-19(13-3-4-18(17(26)5-13)31-11-21(36)24(27,28)29)34-20-10-32-23(35-22(16)20)33-15-6-14(25)8-30-9-15/h3-5,7,10,12,14-15,21,30-31,36H,6,8-9,11H2,1-2H3,(H,32,33,35)/t14-,15-,21?/m0/s1 |
| InChIKey | GDTUZRGFZPRXBO-CJUKTHODSA-N |
| XLogP | 4.40 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |