C23H34F3N9 — CID 154687310
1-cyclohexyl-3-[4-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 154687310) has the molecular formula C23H34F3N9 and a molecular weight of 493.58 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-cyclohexyl-3-[4-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 154687310 |
| Molecular Formula | C23H34F3N9 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | 1-cyclohexyl-3-[4-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | Cc1cc(Nc2ccnc(NC3CCC(N/C(=N/CC(F)(F)F)NC4CCCCC4)CC3)n2)n[nH]1 |
| InChI | InChI=1S/C23H34F3N9/c1-15-13-20(35-34-15)32-19-11-12-27-21(33-19)30-17-7-9-18(10-8-17)31-22(28-14-23(24,25)26)29-16-5-3-2-4-6-16/h11-13,16-18H,2-10,14H2,1H3,(H2,28,29,31)(H3,27,30,32,33,34,35) |
| InChIKey | PCMMHZFCMGGSDV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|