About acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane
acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane (PubChem CID 154687824) has the molecular formula C18H30N4O
and a molecular weight of 318.47 g/mol. Its IUPAC name is acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane.
Molecular Properties
| Compound Name | acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane |
| PubChem CID | 154687824 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane |
| SMILES | CC=O.CCC.CNc1cccc(-c2cnn(CCCN)c2)c1 |
| InChI | InChI=1S/C13H18N4.C3H8.C2H4O/c1-15-13-5-2-4-11(8-13)12-9-16-17(10-12)7-3-6-14;1-3-2;1-2-3/h2,4-5,8-10,15H,3,6-7,14H2,1H3;3H2,1-2H3;2H,1H3 |
| InChIKey | HJZALRAXEIBMBN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane?
The IUPAC name of acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane (CID 154687824) is acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane.
What is the SMILES notation for acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane?
The canonical SMILES for acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane is CC=O.CCC.CNc1cccc(-c2cnn(CCCN)c2)c1.
What is the InChIKey of acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane?
The InChIKey is HJZALRAXEIBMBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4.C3H8.C2H4O/c1-15-13-5-2-4-11(8-13)12-9-16-17(10-12)7-3-6-14;1-3-2;1-2-3/h2,4-5,8-10,15H,3,6-7,14H2,1H3;3H2,1-2H3;2H,1H3.
What are the key properties of acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane?
acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane has a molecular weight of 318.47 g/mol, XLogP of 3.56, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;3-[1-(3-aminopropyl)pyrazol-4-yl]-N-methylaniline;propane is sourced from PubChem (CID 154687824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).