C23H34O2 — CID 15468796
2-(2-tert-butyl-4-methylpenta-2,3-dienyl)-2-nona-2,8-diynyl-1,3-dioxane (PubChem CID 15468796) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 2-(2-tert-butyl-4-methylpenta-2,3-dienyl)-2-nona-2,8-diynyl-1,3-dioxane.
| Compound Name | 2-(2-tert-butyl-4-methylpenta-2,3-dienyl)-2-nona-2,8-diynyl-1,3-dioxane |
|---|---|
| PubChem CID | 15468796 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 2-(2-tert-butyl-4-methylpenta-2,3-dienyl)-2-nona-2,8-diynyl-1,3-dioxane |
| SMILES | C#CCCCCC#CCC1(CC(=C=C(C)C)C(C)(C)C)OCCCO1 |
| InChI | InChI=1S/C23H34O2/c1-7-8-9-10-11-12-13-15-23(24-16-14-17-25-23)19-21(18-20(2)3)22(4,5)6/h1H,8-11,14-17,19H2,2-6H3 |
| InChIKey | BACYZPVEQDAHLY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|