C16H25N3O — CID 154688297
4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-8-methyl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 154688297) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-8-methyl-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-8-methyl-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 154688297 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-8-methyl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | C=C/C=C\C(=C/C)CN1C(=O)CNC12CCN(C)CC2 |
| InChI | InChI=1S/C16H25N3O/c1-4-6-7-14(5-2)13-19-15(20)12-17-16(19)8-10-18(3)11-9-16/h4-7,17H,1,8-13H2,2-3H3/b7-6-,14-5+ |
| InChIKey | CNVQQQITJFNUTF-WFRORPSUSA-N |
| XLogP | 1.53 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|