C21H24N2O3 — CID 154689061
hexane-2,4-dione;1-[4-(1H-indol-3-yl)-2-methyl-1H-pyrrol-3-yl]ethanone (PubChem CID 154689061) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is hexane-2,4-dione;1-[4-(1H-indol-3-yl)-2-methyl-1H-pyrrol-3-yl]ethanone.
| Compound Name | hexane-2,4-dione;1-[4-(1H-indol-3-yl)-2-methyl-1H-pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 154689061 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | hexane-2,4-dione;1-[4-(1H-indol-3-yl)-2-methyl-1H-pyrrol-3-yl]ethanone |
| SMILES | CC(=O)c1c(-c2c[nH]c3ccccc23)c[nH]c1C.CCC(=O)CC(C)=O |
| InChI | InChI=1S/C15H14N2O.C6H10O2/c1-9-15(10(2)18)13(8-16-9)12-7-17-14-6-4-3-5-11(12)14;1-3-6(8)4-5(2)7/h3-8,16-17H,1-2H3;3-4H2,1-2H3 |
| InChIKey | ZUEVMEGHQPBIQH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|