C26H30FN5O2 — CID 154689202
4-[3-amino-4-[5-(4-hydroxycyclohexyl)-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboximidoyl]phenyl]-5-ethyl-2-fluorophenol (PubChem CID 154689202) has the molecular formula C26H30FN5O2 and a molecular weight of 463.56 g/mol. Its IUPAC name is 4-[3-amino-4-[5-(4-hydroxycyclohexyl)-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboximidoyl]phenyl]-5-ethyl-2-fluorophenol.
| Compound Name | 4-[3-amino-4-[5-(4-hydroxycyclohexyl)-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboximidoyl]phenyl]-5-ethyl-2-fluorophenol |
|---|---|
| PubChem CID | 154689202 |
| Molecular Formula | C26H30FN5O2 |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 4-[3-amino-4-[5-(4-hydroxycyclohexyl)-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboximidoyl]phenyl]-5-ethyl-2-fluorophenol |
| SMILES | [H]/N=C(/c1nc2c([nH]1)CN(C1CCC(O)CC1)C2)c1ccc(-c2cc(F)c(O)cc2CC)cc1N |
| InChI | InChI=1S/C26H30FN5O2/c1-2-14-10-24(34)20(27)11-19(14)15-3-8-18(21(28)9-15)25(29)26-30-22-12-32(13-23(22)31-26)16-4-6-17(33)7-5-16/h3,8-11,16-17,29,33-34H,2,4-7,12-13,28H2,1H3,(H,30,31)/b29-25+ |
| InChIKey | ZZMIRCFLNILIPE-XLVZBRSZSA-N |
| XLogP | 4.10 |
| TPSA | 122.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|