About 1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane
1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane (PubChem CID 154689264) has the molecular formula C20H29NO
and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane.
Molecular Properties
| Compound Name | 1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane |
| PubChem CID | 154689264 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane |
| SMILES | C=C/N=C(\C)c1ccc(OC2=CCCC=C2)cc1.CC.CC |
| InChI | InChI=1S/C16H17NO.2C2H6/c1-3-17-13(2)14-9-11-16(12-10-14)18-15-7-5-4-6-8-15;2*1-2/h3,5,7-12H,1,4,6H2,2H3;2*1-2H3/b17-13+;; |
| InChIKey | PHEPAOCUCYQWMK-ZEIDDFDZSA-N |
| XLogP | 6.30 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane?
The IUPAC name of 1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane (CID 154689264) is 1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane.
What is the SMILES notation for 1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane?
The canonical SMILES for 1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane is C=C/N=C(\C)c1ccc(OC2=CCCC=C2)cc1.CC.CC.
What is the InChIKey of 1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane?
The InChIKey is PHEPAOCUCYQWMK-ZEIDDFDZSA-N. The full InChI is InChI=1S/C16H17NO.2C2H6/c1-3-17-13(2)14-9-11-16(12-10-14)18-15-7-5-4-6-8-15;2*1-2/h3,5,7-12H,1,4,6H2,2H3;2*1-2H3/b17-13+;;.
What are the key properties of 1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane?
1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane has a molecular weight of 299.46 g/mol, XLogP of 6.30, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)-N-ethenylethanimine;ethane is sourced from PubChem (CID 154689264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).