About ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile
ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile (PubChem CID 154689469) has the molecular formula C13H22FN3
and a molecular weight of 239.34 g/mol. Its IUPAC name is ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile |
| PubChem CID | 154689469 |
| Molecular Formula | C13H22FN3 |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile |
| SMILES | CC.CNCCN(C)C1=C(F)C=C(C#N)CC1 |
| InChI | InChI=1S/C11H16FN3.C2H6/c1-14-5-6-15(2)11-4-3-9(8-13)7-10(11)12;1-2/h7,14H,3-6H2,1-2H3;1-2H3 |
| InChIKey | YNTLJSRITBYLKO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile (CID 154689469) is ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile is CC.CNCCN(C)C1=C(F)C=C(C#N)CC1.
What is the InChIKey of ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is YNTLJSRITBYLKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16FN3.C2H6/c1-14-5-6-15(2)11-4-3-9(8-13)7-10(11)12;1-2/h7,14H,3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile?
ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 239.34 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-fluoro-4-[methyl-[2-(methylamino)ethyl]amino]cyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 154689469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).