About 4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole
4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole (PubChem CID 154689569) has the molecular formula C25H42N4S
and a molecular weight of 430.71 g/mol. Its IUPAC name is 4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole |
| PubChem CID | 154689569 |
| Molecular Formula | C25H42N4S |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | 4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole |
| SMILES | c1cc2c(c(SCCCCCCCCN3CCC(N4CCNCC4)CC3)c1)CNC2 |
| InChI | InChI=1S/C25H42N4S/c1(2-4-6-19-30-25-9-7-8-22-20-27-21-24(22)25)3-5-14-28-15-10-23(11-16-28)29-17-12-26-13-18-29/h7-9,23,26-27H,1-6,10-21H2 |
| InChIKey | LCAMZPLSZYLSGC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole?
The IUPAC name of 4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole (CID 154689569) is 4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole.
What is the SMILES notation for 4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole?
The canonical SMILES for 4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole is c1cc2c(c(SCCCCCCCCN3CCC(N4CCNCC4)CC3)c1)CNC2.
What is the InChIKey of 4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole?
The InChIKey is LCAMZPLSZYLSGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H42N4S/c1(2-4-6-19-30-25-9-7-8-22-20-27-21-24(22)25)3-5-14-28-15-10-23(11-16-28)29-17-12-26-13-18-29/h7-9,23,26-27H,1-6,10-21H2.
What are the key properties of 4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole?
4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole has a molecular weight of 430.71 g/mol, XLogP of 4.09, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[8-(4-piperazin-1-ylpiperidin-1-yl)octylsulfanyl]-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 154689569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).