About (5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one
(5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 154690553) has the molecular formula C14H15N2O4+
and a molecular weight of 275.28 g/mol. Its IUPAC name is (5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one |
| PubChem CID | 154690553 |
| Molecular Formula | C14H15N2O4+ |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](c2ccccc2)CN1C1CCC(=O)[N+](=O)C1 |
| InChI | InChI=1S/C14H15N2O4/c17-13-7-6-11(8-16(13)19)15-9-12(20-14(15)18)10-4-2-1-3-5-10/h1-5,11-12H,6-9H2/q+1/t11?,12-/m1/s1 |
| InChIKey | ZOFOWYZVYSUPPY-PIJUOVFKSA-N |
| XLogP | 1.65 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one?
The IUPAC name of (5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one (CID 154690553) is (5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one.
What is the SMILES notation for (5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one?
The canonical SMILES for (5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one is O=C1O[C@@H](c2ccccc2)CN1C1CCC(=O)[N+](=O)C1.
What is the InChIKey of (5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one?
The InChIKey is ZOFOWYZVYSUPPY-PIJUOVFKSA-N. The full InChI is InChI=1S/C14H15N2O4/c17-13-7-6-11(8-16(13)19)15-9-12(20-14(15)18)10-4-2-1-3-5-10/h1-5,11-12H,6-9H2/q+1/t11?,12-/m1/s1.
What are the key properties of (5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one?
(5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one has a molecular weight of 275.28 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3-(1,6-dioxopiperidin-1-ium-3-yl)-5-phenyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 154690553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).