About ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate
ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate (PubChem CID 154690875) has the molecular formula C13H11BrN4O2
and a molecular weight of 335.16 g/mol. Its IUPAC name is ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate |
| PubChem CID | 154690875 |
| Molecular Formula | C13H11BrN4O2 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccn3ncc(Br)c3c2)c1 |
| InChI | InChI=1S/C13H11BrN4O2/c1-2-20-13(19)9-6-15-18(8-9)10-3-4-17-12(5-10)11(14)7-16-17/h3-8H,2H2,1H3 |
| InChIKey | BQPSDKYOFJLNEP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate?
The IUPAC name of ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate (CID 154690875) is ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate?
The canonical SMILES for ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate is CCOC(=O)c1cnn(-c2ccn3ncc(Br)c3c2)c1.
What is the InChIKey of ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate?
The InChIKey is BQPSDKYOFJLNEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrN4O2/c1-2-20-13(19)9-6-15-18(8-9)10-3-4-17-12(5-10)11(14)7-16-17/h3-8H,2H2,1H3.
What are the key properties of ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate?
ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate has a molecular weight of 335.16 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(3-bromopyrazolo[1,5-a]pyridin-5-yl)pyrazole-4-carboxylate is sourced from PubChem (CID 154690875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).