About 3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one
3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one (PubChem CID 154691232) has the molecular formula C19H18FN3O2
and a molecular weight of 339.37 g/mol. Its IUPAC name is 3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one |
| PubChem CID | 154691232 |
| Molecular Formula | C19H18FN3O2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one |
| SMILES | CN(C)Cc1[nH]c2ccc(F)cc2c1C1NC(=O)c2ccc(O)cc21 |
| InChI | InChI=1S/C19H18FN3O2/c1-23(2)9-16-17(14-7-10(20)3-6-15(14)21-16)18-13-8-11(24)4-5-12(13)19(25)22-18/h3-8,18,21,24H,9H2,1-2H3,(H,22,25) |
| InChIKey | SDTNLHOUOODEHZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one?
The IUPAC name of 3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one (CID 154691232) is 3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one?
The canonical SMILES for 3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one is CN(C)Cc1[nH]c2ccc(F)cc2c1C1NC(=O)c2ccc(O)cc21.
What is the InChIKey of 3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one?
The InChIKey is SDTNLHOUOODEHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FN3O2/c1-23(2)9-16-17(14-7-10(20)3-6-15(14)21-16)18-13-8-11(24)4-5-12(13)19(25)22-18/h3-8,18,21,24H,9H2,1-2H3,(H,22,25).
What are the key properties of 3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one?
3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one has a molecular weight of 339.37 g/mol, XLogP of 2.91, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(dimethylamino)methyl]-5-fluoro-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 154691232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).