C31H33N5O2 — CID 154691304
3-[2-[[6-(7-azabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-4-ylmethylamino)hexylamino]methyl]-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one (PubChem CID 154691304) has the molecular formula C31H33N5O2 and a molecular weight of 507.64 g/mol. Its IUPAC name is 3-[2-[[6-(7-azabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-4-ylmethylamino)hexylamino]methyl]-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one.
| Compound Name | 3-[2-[[6-(7-azabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-4-ylmethylamino)hexylamino]methyl]-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 154691304 |
| Molecular Formula | C31H33N5O2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 3-[2-[[6-(7-azabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-4-ylmethylamino)hexylamino]methyl]-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NC(c2c(CNCCCCCCNCc3ccc4c(c3)N=C4)[nH]c3ccccc23)c2cc(O)ccc21 |
| InChI | InChI=1S/C31H33N5O2/c37-22-11-12-23-25(16-22)30(36-31(23)38)29-24-7-3-4-8-26(24)35-28(29)19-33-14-6-2-1-5-13-32-17-20-9-10-21-18-34-27(21)15-20/h3-4,7-12,15-16,18,30,32-33,35,37H,1-2,5-6,13-14,17,19H2,(H,36,38) |
| InChIKey | CNCNSNAEXQFDNV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|