About 5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol
5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol (PubChem CID 154691414) has the molecular formula C16H31NO4
and a molecular weight of 301.43 g/mol. Its IUPAC name is 5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | 5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol |
| PubChem CID | 154691414 |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | 5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol |
| SMILES | CC(C)CCN1C(=O)C=CC1(C)O.COC(C)(C)CCO |
| InChI | InChI=1S/C10H17NO2.C6H14O2/c1-8(2)5-7-11-9(12)4-6-10(11,3)13;1-6(2,8-3)4-5-7/h4,6,8,13H,5,7H2,1-3H3;7H,4-5H2,1-3H3 |
| InChIKey | DLVRDZFKHSQLAQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol?
The IUPAC name of 5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol (CID 154691414) is 5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol.
What is the SMILES notation for 5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol?
The canonical SMILES for 5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol is CC(C)CCN1C(=O)C=CC1(C)O.COC(C)(C)CCO.
What is the InChIKey of 5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol?
The InChIKey is DLVRDZFKHSQLAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2.C6H14O2/c1-8(2)5-7-11-9(12)4-6-10(11,3)13;1-6(2,8-3)4-5-7/h4,6,8,13H,5,7H2,1-3H3;7H,4-5H2,1-3H3.
What are the key properties of 5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol?
5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol has a molecular weight of 301.43 g/mol, XLogP of 1.93, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-5-methyl-1-(3-methylbutyl)pyrrol-2-one;3-methoxy-3-methylbutan-1-ol is sourced from PubChem (CID 154691414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).