C14H12F5N3O2S — CID 154691519
2-(3-ethylsulfanyl-2-pyridinyl)-5-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one (PubChem CID 154691519) has the molecular formula C14H12F5N3O2S and a molecular weight of 381.33 g/mol. Its IUPAC name is 2-(3-ethylsulfanyl-2-pyridinyl)-5-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one.
| Compound Name | 2-(3-ethylsulfanyl-2-pyridinyl)-5-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 154691519 |
| Molecular Formula | C14H12F5N3O2S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 2-(3-ethylsulfanyl-2-pyridinyl)-5-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one |
| SMILES | CCSc1cccnc1-c1ncc(OCC(F)(F)C(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C14H12F5N3O2S/c1-2-25-9-4-3-5-20-10(9)11-21-6-8(12(23)22-11)24-7-13(15,16)14(17,18)19/h3-6H,2,7H2,1H3,(H,21,22,23) |
| InChIKey | JWYQKOKWJKTTIU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|