C17H27NO4 — CID 154691708
5-[(E)-3-(dibutylamino)prop-2-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 154691708) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 5-[(E)-3-(dibutylamino)prop-2-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(E)-3-(dibutylamino)prop-2-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 154691708 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 5-[(E)-3-(dibutylamino)prop-2-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCCCN(/C=C/C=C1C(=O)OC(C)(C)OC1=O)CCCC |
| InChI | InChI=1S/C17H27NO4/c1-5-7-11-18(12-8-6-2)13-9-10-14-15(19)21-17(3,4)22-16(14)20/h9-10,13H,5-8,11-12H2,1-4H3/b13-9+ |
| InChIKey | QPXOYOFUSGHIGI-UKTHLTGXSA-N |
| XLogP | 3.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|