About 3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one
3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 154691812) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is 3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one |
| PubChem CID | 154691812 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | CCCN(CC)C1=CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C13H23NO/c1-5-7-14(6-2)11-8-12(15)10-13(3,4)9-11/h8H,5-7,9-10H2,1-4H3 |
| InChIKey | GNAISETVXSNIEX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one?
The IUPAC name of 3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one (CID 154691812) is 3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one is CCCN(CC)C1=CC(=O)CC(C)(C)C1.
What is the InChIKey of 3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one?
The InChIKey is GNAISETVXSNIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO/c1-5-7-14(6-2)11-8-12(15)10-13(3,4)9-11/h8H,5-7,9-10H2,1-4H3.
What are the key properties of 3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one?
3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one has a molecular weight of 209.33 g/mol, XLogP of 2.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl(propyl)amino]-5,5-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 154691812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).