About acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol
acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol (PubChem CID 154692141) has the molecular formula C23H29OP
and a molecular weight of 352.46 g/mol. Its IUPAC name is acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol.
Molecular Properties
| Compound Name | acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol |
| PubChem CID | 154692141 |
| Molecular Formula | C23H29OP |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol |
| SMILES | C#C.C/C=C\C=C(/C)P(c1ccccc1)C(O)c1ccccc1.CC |
| InChI | InChI=1S/C19H21OP.C2H6.C2H2/c1-3-4-11-16(2)21(18-14-9-6-10-15-18)19(20)17-12-7-5-8-13-17;2*1-2/h3-15,19-20H,1-2H3;1-2H3;1-2H/b4-3-,16-11+;; |
| InChIKey | UETAYZRTZDCKOL-FIQASCFYSA-N |
| XLogP | 6.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol?
The IUPAC name of acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol (CID 154692141) is acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol.
What is the SMILES notation for acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol?
The canonical SMILES for acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol is C#C.C/C=C\C=C(/C)P(c1ccccc1)C(O)c1ccccc1.CC.
What is the InChIKey of acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol?
The InChIKey is UETAYZRTZDCKOL-FIQASCFYSA-N. The full InChI is InChI=1S/C19H21OP.C2H6.C2H2/c1-3-4-11-16(2)21(18-14-9-6-10-15-18)19(20)17-12-7-5-8-13-17;2*1-2/h3-15,19-20H,1-2H3;1-2H3;1-2H/b4-3-,16-11+;;.
What are the key properties of acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol?
acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol has a molecular weight of 352.46 g/mol, XLogP of 6.24, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;ethane;[[(2E,4Z)-hexa-2,4-dien-2-yl]-phenylphosphanyl]-phenylmethanol is sourced from PubChem (CID 154692141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).