About (E)-2-ethoxy-N,N-dimethylethenamine
(E)-2-ethoxy-N,N-dimethylethenamine (PubChem CID 15469240) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is (E)-2-ethoxy-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | (E)-2-ethoxy-N,N-dimethylethenamine |
| PubChem CID | 15469240 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | (E)-2-ethoxy-N,N-dimethylethenamine |
| SMILES | CCO/C=C/N(C)C |
| InChI | InChI=1S/C6H13NO/c1-4-8-6-5-7(2)3/h5-6H,4H2,1-3H3/b6-5+ |
| InChIKey | KNAGBABVYYMJRI-AATRIKPKSA-N |
| XLogP | 1.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-ethoxy-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-ethoxy-N,N-dimethylethenamine?
The IUPAC name of (E)-2-ethoxy-N,N-dimethylethenamine (CID 15469240) is (E)-2-ethoxy-N,N-dimethylethenamine.
What is the SMILES notation for (E)-2-ethoxy-N,N-dimethylethenamine?
The canonical SMILES for (E)-2-ethoxy-N,N-dimethylethenamine is CCO/C=C/N(C)C.
What is the InChIKey of (E)-2-ethoxy-N,N-dimethylethenamine?
The InChIKey is KNAGBABVYYMJRI-AATRIKPKSA-N. The full InChI is InChI=1S/C6H13NO/c1-4-8-6-5-7(2)3/h5-6H,4H2,1-3H3/b6-5+.
What are the key properties of (E)-2-ethoxy-N,N-dimethylethenamine?
(E)-2-ethoxy-N,N-dimethylethenamine has a molecular weight of 115.18 g/mol, XLogP of 1.06, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-ethoxy-N,N-dimethylethenamine is sourced from PubChem (CID 15469240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).