C21H18BrNO2 — CID 15469331
13-(2-bromo-4-methylphenyl)-6-methyl-3-oxa-13-azatetracyclo[8.5.0.02,7.012,14]pentadeca-1(10),2(7),5,8-tetraen-4-one (PubChem CID 15469331) has the molecular formula C21H18BrNO2 and a molecular weight of 396.28 g/mol. Its IUPAC name is 13-(2-bromo-4-methylphenyl)-6-methyl-3-oxa-13-azatetracyclo[8.5.0.02,7.012,14]pentadeca-1(10),2(7),5,8-tetraen-4-one.
| Compound Name | 13-(2-bromo-4-methylphenyl)-6-methyl-3-oxa-13-azatetracyclo[8.5.0.02,7.012,14]pentadeca-1(10),2(7),5,8-tetraen-4-one |
|---|---|
| PubChem CID | 15469331 |
| Molecular Formula | C21H18BrNO2 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 13-(2-bromo-4-methylphenyl)-6-methyl-3-oxa-13-azatetracyclo[8.5.0.02,7.012,14]pentadeca-1(10),2(7),5,8-tetraen-4-one |
| SMILES | Cc1ccc(N2C3Cc4ccc5c(C)cc(=O)oc5c4CC32)c(Br)c1 |
| InChI | InChI=1S/C21H18BrNO2/c1-11-3-6-17(16(22)7-11)23-18-9-13-4-5-14-12(2)8-20(24)25-21(14)15(13)10-19(18)23/h3-8,18-19H,9-10H2,1-2H3 |
| InChIKey | NOIXGOOJXDAYOH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 33.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|