C31H29F3N6O2 — CID 154693350
3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[4-[[2-(4-oxopiperidin-1-yl)ethylamino]methyl]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 154693350) has the molecular formula C31H29F3N6O2 and a molecular weight of 574.61 g/mol. Its IUPAC name is 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[4-[[2-(4-oxopiperidin-1-yl)ethylamino]methyl]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[4-[[2-(4-oxopiperidin-1-yl)ethylamino]methyl]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 154693350 |
| Molecular Formula | C31H29F3N6O2 |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[4-[[2-(4-oxopiperidin-1-yl)ethylamino]methyl]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CNCCN3CCC(=O)CC3)c(C(F)(F)F)c2)cc1C#Cc1cnc2cccnn12 |
| InChI | InChI=1S/C31H29F3N6O2/c1-21-4-5-23(17-22(21)7-9-26-20-36-29-3-2-12-37-40(26)29)30(42)38-25-8-6-24(28(18-25)31(32,33)34)19-35-13-16-39-14-10-27(41)11-15-39/h2-6,8,12,17-18,20,35H,10-11,13-16,19H2,1H3,(H,38,42) |
| InChIKey | NFWVSGNAAWFMML-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|