About ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate
ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate (PubChem CID 154693712) has the molecular formula C16H17BrO3
and a molecular weight of 337.21 g/mol. Its IUPAC name is ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate |
| PubChem CID | 154693712 |
| Molecular Formula | C16H17BrO3 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate |
| SMILES | CCOC(=O)C1(C)CCc2c(oc3ccc(Br)cc23)C1 |
| InChI | InChI=1S/C16H17BrO3/c1-3-19-15(18)16(2)7-6-11-12-8-10(17)4-5-13(12)20-14(11)9-16/h4-5,8H,3,6-7,9H2,1-2H3 |
| InChIKey | RVODOCYWVDLVOY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate?
The IUPAC name of ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate (CID 154693712) is ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate.
What is the SMILES notation for ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate?
The canonical SMILES for ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate is CCOC(=O)C1(C)CCc2c(oc3ccc(Br)cc23)C1.
What is the InChIKey of ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate?
The InChIKey is RVODOCYWVDLVOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17BrO3/c1-3-19-15(18)16(2)7-6-11-12-8-10(17)4-5-13(12)20-14(11)9-16/h4-5,8H,3,6-7,9H2,1-2H3.
What are the key properties of ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate?
ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate has a molecular weight of 337.21 g/mol, XLogP of 4.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-bromo-3-methyl-2,4-dihydro-1H-dibenzofuran-3-carboxylate is sourced from PubChem (CID 154693712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).