C20H20O3 — CID 154694040
ethyl 4-[4-(2-phenylethynyl)phenoxy]butanoate (PubChem CID 154694040) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is ethyl 4-[4-(2-phenylethynyl)phenoxy]butanoate.
| Compound Name | ethyl 4-[4-(2-phenylethynyl)phenoxy]butanoate |
|---|---|
| PubChem CID | 154694040 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethyl 4-[4-(2-phenylethynyl)phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H20O3/c1-2-22-20(21)9-6-16-23-19-14-12-18(13-15-19)11-10-17-7-4-3-5-8-17/h3-5,7-8,12-15H,2,6,9,16H2,1H3 |
| InChIKey | MNSZWJIJWCGFBH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|