C12H17N — CID 154694138
N-[(2S)-2-(5-methylcyclohepta-1,3,6-trien-1-yl)propyl]methanimine (PubChem CID 154694138) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is N-[(2S)-2-(5-methylcyclohepta-1,3,6-trien-1-yl)propyl]methanimine.
| Compound Name | N-[(2S)-2-(5-methylcyclohepta-1,3,6-trien-1-yl)propyl]methanimine |
|---|---|
| PubChem CID | 154694138 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N-[(2S)-2-(5-methylcyclohepta-1,3,6-trien-1-yl)propyl]methanimine |
| SMILES | C=NC[C@@H](C)C1=CC=CC(C)C=C1 |
| InChI | InChI=1S/C12H17N/c1-10-5-4-6-12(8-7-10)11(2)9-13-3/h4-8,10-11H,3,9H2,1-2H3/t10?,11-/m1/s1 |
| InChIKey | VFNVYZXRYXMCON-RRKGBCIJSA-N |
| XLogP | 3.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|