C15H20N2O — CID 154694313
8-methoxy-3,6-dimethyl-1,2,4,5-tetrahydroazepino[4,5-b]indole (PubChem CID 154694313) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 8-methoxy-3,6-dimethyl-1,2,4,5-tetrahydroazepino[4,5-b]indole.
| Compound Name | 8-methoxy-3,6-dimethyl-1,2,4,5-tetrahydroazepino[4,5-b]indole |
|---|---|
| PubChem CID | 154694313 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 8-methoxy-3,6-dimethyl-1,2,4,5-tetrahydroazepino[4,5-b]indole |
| SMILES | COc1ccc2c3c(n(C)c2c1)CCN(C)CC3 |
| InChI | InChI=1S/C15H20N2O/c1-16-8-6-13-12-5-4-11(18-3)10-15(12)17(2)14(13)7-9-16/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | GBPLGMMNHBMFAD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|