C22H32O2 — CID 154694686
(8R,9S,10R,13R,14S,17S)-17-methoxy-17-methyl-13-propan-2-yl-1,2,6,7,8,9,10,11,12,14-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 154694686) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (8R,9S,10R,13R,14S,17S)-17-methoxy-17-methyl-13-propan-2-yl-1,2,6,7,8,9,10,11,12,14-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13R,14S,17S)-17-methoxy-17-methyl-13-propan-2-yl-1,2,6,7,8,9,10,11,12,14-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154694686 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (8R,9S,10R,13R,14S,17S)-17-methoxy-17-methyl-13-propan-2-yl-1,2,6,7,8,9,10,11,12,14-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CO[C@@]1(C)C=C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3CC[C@@]21C(C)C |
| InChI | InChI=1S/C22H32O2/c1-14(2)22-12-9-18-17-8-6-16(23)13-15(17)5-7-19(18)20(22)10-11-21(22,3)24-4/h10-11,13-14,17-20H,5-9,12H2,1-4H3/t17-,18+,19+,20-,21-,22+/m0/s1 |
| InChIKey | SPEUCGPJDLEKTI-REGVOWLASA-N |
| XLogP | 4.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|