C12H17NO — CID 15469540
N-[(1R)-1-(2,4,6-trimethylphenyl)ethyl]formamide (PubChem CID 15469540) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is N-[(1R)-1-(2,4,6-trimethylphenyl)ethyl]formamide.
| Compound Name | N-[(1R)-1-(2,4,6-trimethylphenyl)ethyl]formamide |
|---|---|
| PubChem CID | 15469540 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-[(1R)-1-(2,4,6-trimethylphenyl)ethyl]formamide |
| SMILES | Cc1cc(C)c([C@@H](C)NC=O)c(C)c1 |
| InChI | InChI=1S/C12H17NO/c1-8-5-9(2)12(10(3)6-8)11(4)13-7-14/h5-7,11H,1-4H3,(H,13,14)/t11-/m1/s1 |
| InChIKey | GHDLXNZKJQXLKH-LLVKDONJSA-N |
| XLogP | 2.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|