C24H22N4O2S — CID 154695577
N-[4-[(E)-3-phenylmethoxyprop-1-enyl]-1,3-thiazol-2-yl]-1-(pyridin-4-ylmethyl)pyrrole-2-carboxamide (PubChem CID 154695577) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-[4-[(E)-3-phenylmethoxyprop-1-enyl]-1,3-thiazol-2-yl]-1-(pyridin-4-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | N-[4-[(E)-3-phenylmethoxyprop-1-enyl]-1,3-thiazol-2-yl]-1-(pyridin-4-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 154695577 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-[4-[(E)-3-phenylmethoxyprop-1-enyl]-1,3-thiazol-2-yl]-1-(pyridin-4-ylmethyl)pyrrole-2-carboxamide |
| SMILES | O=C(Nc1nc(/C=C/COCc2ccccc2)cs1)c1cccn1Cc1ccncc1 |
| InChI | InChI=1S/C24H22N4O2S/c29-23(22-9-4-14-28(22)16-19-10-12-25-13-11-19)27-24-26-21(18-31-24)8-5-15-30-17-20-6-2-1-3-7-20/h1-14,18H,15-17H2,(H,26,27,29)/b8-5+ |
| InChIKey | VVGHVXXHKKUJGT-VMPITWQZSA-N |
| XLogP | 4.87 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|