C19H16ClNO2 — CID 154697558
1-(1,2,3,6-tetrahydropyridin-4-yl)anthracene-9,10-dione;hydrochloride (PubChem CID 154697558) has the molecular formula C19H16ClNO2 and a molecular weight of 325.79 g/mol. Its IUPAC name is 1-(1,2,3,6-tetrahydropyridin-4-yl)anthracene-9,10-dione;hydrochloride.
| Compound Name | 1-(1,2,3,6-tetrahydropyridin-4-yl)anthracene-9,10-dione;hydrochloride |
|---|---|
| PubChem CID | 154697558 |
| Molecular Formula | C19H16ClNO2 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 1-(1,2,3,6-tetrahydropyridin-4-yl)anthracene-9,10-dione;hydrochloride |
| SMILES | Cl.O=C1c2ccccc2C(=O)c2c1cccc2C1=CCNCC1 |
| InChI | InChI=1S/C19H15NO2.ClH/c21-18-14-4-1-2-5-15(14)19(22)17-13(6-3-7-16(17)18)12-8-10-20-11-9-12;/h1-8,20H,9-11H2;1H |
| InChIKey | FCTPSZXVISSJCK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|