About [2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol
[2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol (PubChem CID 15469786) has the molecular formula C16H24F2O3Si
and a molecular weight of 330.45 g/mol. Its IUPAC name is [2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol.
Molecular Properties
| Compound Name | [2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol |
| PubChem CID | 15469786 |
| Molecular Formula | C16H24F2O3Si |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | [2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol |
| SMILES | COc1ccc(COCC2C(F)(F)C2(CO)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C16H24F2O3Si/c1-20-13-7-5-12(6-8-13)9-21-10-14-15(11-19,16(14,17)18)22(2,3)4/h5-8,14,19H,9-11H2,1-4H3 |
| InChIKey | JVUAFMPTYYLFHF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol?
The IUPAC name of [2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol (CID 15469786) is [2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol.
What is the SMILES notation for [2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol?
The canonical SMILES for [2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol is COc1ccc(COCC2C(F)(F)C2(CO)[Si](C)(C)C)cc1.
What is the InChIKey of [2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol?
The InChIKey is JVUAFMPTYYLFHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24F2O3Si/c1-20-13-7-5-12(6-8-13)9-21-10-14-15(11-19,16(14,17)18)22(2,3)4/h5-8,14,19H,9-11H2,1-4H3.
What are the key properties of [2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol?
[2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol has a molecular weight of 330.45 g/mol, XLogP of 3.55, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-3-[(4-methoxyphenyl)methoxymethyl]-1-trimethylsilylcyclopropyl]methanol is sourced from PubChem (CID 15469786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).