C15H10N2O — CID 154697925
12-amino-15-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,10,12-heptaen-14-one (PubChem CID 154697925) has the molecular formula C15H10N2O and a molecular weight of 234.26 g/mol. Its IUPAC name is 12-amino-15-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,10,12-heptaen-14-one.
| Compound Name | 12-amino-15-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,10,12-heptaen-14-one |
|---|---|
| PubChem CID | 154697925 |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 12-amino-15-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,10,12-heptaen-14-one |
| SMILES | Nc1ccc2cc3ccccc3c3c2c1C(=O)N3 |
| InChI | InChI=1S/C15H10N2O/c16-11-6-5-9-7-8-3-1-2-4-10(8)14-12(9)13(11)15(18)17-14/h1-7H,16H2,(H,17,18) |
| InChIKey | PMCUVTSRMSEYPY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|