C18H10BrFN4O2S — CID 154698543
sulfanyl 2-(4-bromo-2-fluorophenyl)-7-pyridin-4-ylpyrazolo[1,5-a]pyrimidine-5-carboxylate (PubChem CID 154698543) has the molecular formula C18H10BrFN4O2S and a molecular weight of 445.27 g/mol. Its IUPAC name is sulfanyl 2-(4-bromo-2-fluorophenyl)-7-pyridin-4-ylpyrazolo[1,5-a]pyrimidine-5-carboxylate.
| Compound Name | sulfanyl 2-(4-bromo-2-fluorophenyl)-7-pyridin-4-ylpyrazolo[1,5-a]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 154698543 |
| Molecular Formula | C18H10BrFN4O2S |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 443.97 |
| IUPAC Name | sulfanyl 2-(4-bromo-2-fluorophenyl)-7-pyridin-4-ylpyrazolo[1,5-a]pyrimidine-5-carboxylate |
| SMILES | O=C(OS)c1cc(-c2ccncc2)n2nc(-c3ccc(Br)cc3F)cc2n1 |
| InChI | InChI=1S/C18H10BrFN4O2S/c19-11-1-2-12(13(20)7-11)14-9-17-22-15(18(25)26-27)8-16(24(17)23-14)10-3-5-21-6-4-10/h1-9,27H |
| InChIKey | MIEXCQOJWRHMRF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 69.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|