About 1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate
1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate (PubChem CID 154699180) has the molecular formula C23H28N2O3
and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | 1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate |
| PubChem CID | 154699180 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate |
| SMILES | Nc1onc(C(=O)OCC23CC4CC(CC(C4)C2)C3)c1CCc1ccccc1 |
| InChI | InChI=1S/C23H28N2O3/c24-21-19(7-6-15-4-2-1-3-5-15)20(25-28-21)22(26)27-14-23-11-16-8-17(12-23)10-18(9-16)13-23/h1-5,16-18H,6-14,24H2 |
| InChIKey | IXHFIORZXDADNG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate?
The IUPAC name of 1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate (CID 154699180) is 1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate.
What is the SMILES notation for 1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate?
The canonical SMILES for 1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate is Nc1onc(C(=O)OCC23CC4CC(CC(C4)C2)C3)c1CCc1ccccc1.
What is the InChIKey of 1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate?
The InChIKey is IXHFIORZXDADNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O3/c24-21-19(7-6-15-4-2-1-3-5-15)20(25-28-21)22(26)27-14-23-11-16-8-17(12-23)10-18(9-16)13-23/h1-5,16-18H,6-14,24H2.
What are the key properties of 1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate?
1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate has a molecular weight of 380.49 g/mol, XLogP of 4.42, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylmethyl 5-amino-4-(2-phenylethyl)-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 154699180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).