C18H26ClNO4 — CID 154699256
(2R,5S)-10-(2-chlorophenyl)-2-methyl-5-propan-2-yl-7,8,12,13-tetraoxa-10-azaspiro[5.7]tridecane (PubChem CID 154699256) has the molecular formula C18H26ClNO4 and a molecular weight of 355.86 g/mol. Its IUPAC name is (2R,5S)-10-(2-chlorophenyl)-2-methyl-5-propan-2-yl-7,8,12,13-tetraoxa-10-azaspiro[5.7]tridecane.
| Compound Name | (2R,5S)-10-(2-chlorophenyl)-2-methyl-5-propan-2-yl-7,8,12,13-tetraoxa-10-azaspiro[5.7]tridecane |
|---|---|
| PubChem CID | 154699256 |
| Molecular Formula | C18H26ClNO4 |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (2R,5S)-10-(2-chlorophenyl)-2-methyl-5-propan-2-yl-7,8,12,13-tetraoxa-10-azaspiro[5.7]tridecane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)CC12OOCN(c1ccccc1Cl)COO2 |
| InChI | InChI=1S/C18H26ClNO4/c1-13(2)15-9-8-14(3)10-18(15)23-21-11-20(12-22-24-18)17-7-5-4-6-16(17)19/h4-7,13-15H,8-12H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | XNPOSIPYMSZOLW-CABCVRRESA-N |
| XLogP | 4.76 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|