About 4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide
4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide (PubChem CID 154699478) has the molecular formula C18H16N2O4
and a molecular weight of 324.34 g/mol. Its IUPAC name is 4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide.
Molecular Properties
| Compound Name | 4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide |
| PubChem CID | 154699478 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide |
| SMILES | CN(C(=O)c1c(O)c2cccc(O)c2n(C)c1=O)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O4/c1-19(11-7-4-3-5-8-11)17(23)14-16(22)12-9-6-10-13(21)15(12)20(2)18(14)24/h3-10,21-22H,1-2H3 |
| InChIKey | AHXNUHLQDWODQB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide?
The IUPAC name of 4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide (CID 154699478) is 4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide.
What is the SMILES notation for 4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide?
The canonical SMILES for 4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide is CN(C(=O)c1c(O)c2cccc(O)c2n(C)c1=O)c1ccccc1.
What is the InChIKey of 4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide?
The InChIKey is AHXNUHLQDWODQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O4/c1-19(11-7-4-3-5-8-11)17(23)14-16(22)12-9-6-10-13(21)15(12)20(2)18(14)24/h3-10,21-22H,1-2H3.
What are the key properties of 4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide?
4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide has a molecular weight of 324.34 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dihydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide is sourced from PubChem (CID 154699478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).