C22H20FN7O — CID 154700389
[4-[5-amino-6-(1H-benzimidazol-2-yl)pyrazin-2-yl]-2-fluorophenyl]-piperazin-1-ylmethanone (PubChem CID 154700389) has the molecular formula C22H20FN7O and a molecular weight of 417.45 g/mol. Its IUPAC name is [4-[5-amino-6-(1H-benzimidazol-2-yl)pyrazin-2-yl]-2-fluorophenyl]-piperazin-1-ylmethanone.
| Compound Name | [4-[5-amino-6-(1H-benzimidazol-2-yl)pyrazin-2-yl]-2-fluorophenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 154700389 |
| Molecular Formula | C22H20FN7O |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [4-[5-amino-6-(1H-benzimidazol-2-yl)pyrazin-2-yl]-2-fluorophenyl]-piperazin-1-ylmethanone |
| SMILES | Nc1ncc(-c2ccc(C(=O)N3CCNCC3)c(F)c2)nc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H20FN7O/c23-15-11-13(5-6-14(15)22(31)30-9-7-25-8-10-30)18-12-26-20(24)19(27-18)21-28-16-3-1-2-4-17(16)29-21/h1-6,11-12,25H,7-10H2,(H2,24,26)(H,28,29) |
| InChIKey | ZPSQBNSDHQDZOD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |