C30H38N8O5S — CID 154700552
(14S,17R)-14-[3-(diaminomethylideneamino)propyl]-3-(furan-2-ylmethyl)-5,12,15-trioxo-19-thia-3,6,13,16-tetrazatricyclo[19.4.0.06,10]pentacosa-1(25),7,9,21,23-pentaene-17-carboxamide (PubChem CID 154700552) has the molecular formula C30H38N8O5S and a molecular weight of 622.75 g/mol. Its IUPAC name is (14S,17R)-14-[3-(diaminomethylideneamino)propyl]-3-(furan-2-ylmethyl)-5,12,15-trioxo-19-thia-3,6,13,16-tetrazatricyclo[19.4.0.06,10]pentacosa-1(25),7,9,21,23-pentaene-17-carboxamide.
| Compound Name | (14S,17R)-14-[3-(diaminomethylideneamino)propyl]-3-(furan-2-ylmethyl)-5,12,15-trioxo-19-thia-3,6,13,16-tetrazatricyclo[19.4.0.06,10]pentacosa-1(25),7,9,21,23-pentaene-17-carboxamide |
|---|---|
| PubChem CID | 154700552 |
| Molecular Formula | C30H38N8O5S |
| Molecular Weight | 622.75 g/mol |
| Exact Mass | 622.27 |
| IUPAC Name | (14S,17R)-14-[3-(diaminomethylideneamino)propyl]-3-(furan-2-ylmethyl)-5,12,15-trioxo-19-thia-3,6,13,16-tetrazatricyclo[19.4.0.06,10]pentacosa-1(25),7,9,21,23-pentaene-17-carboxamide |
| SMILES | NC(=O)[C@@H]1CSCc2ccccc2CN(Cc2ccco2)CC(=O)n2cccc2CC(=O)N[C@@H](CCCN=C(N)N)C(=O)N1 |
| InChI | InChI=1S/C30H38N8O5S/c31-28(41)25-19-44-18-21-7-2-1-6-20(21)15-37(16-23-9-5-13-43-23)17-27(40)38-12-4-8-22(38)14-26(39)35-24(29(42)36-25)10-3-11-34-30(32)33/h1-2,4-9,12-13,24-25H,3,10-11,14-19H2,(H2,31,41)(H,35,39)(H,36,42)(H4,32,33,34)/t24-,25-/m0/s1 |
| InChIKey | JGEVKUBHQRCGEE-DQEYMECFSA-N |
| XLogP | 0.72 |
| TPSA | 204.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.75 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|