About 6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one
6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one (PubChem CID 154700574) has the molecular formula C17H18ClN3OS
and a molecular weight of 347.87 g/mol. Its IUPAC name is 6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one |
| PubChem CID | 154700574 |
| Molecular Formula | C17H18ClN3OS |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one |
| SMILES | CCCCCc1nc(Cn2cnc3ccc(Cl)cc3c2=O)cs1 |
| InChI | InChI=1S/C17H18ClN3OS/c1-2-3-4-5-16-20-13(10-23-16)9-21-11-19-15-7-6-12(18)8-14(15)17(21)22/h6-8,10-11H,2-5,9H2,1H3 |
| InChIKey | NHLFNYUFUYOOKX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one?
The IUPAC name of 6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one (CID 154700574) is 6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one.
What is the SMILES notation for 6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one?
The canonical SMILES for 6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one is CCCCCc1nc(Cn2cnc3ccc(Cl)cc3c2=O)cs1.
What is the InChIKey of 6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one?
The InChIKey is NHLFNYUFUYOOKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN3OS/c1-2-3-4-5-16-20-13(10-23-16)9-21-11-19-15-7-6-12(18)8-14(15)17(21)22/h6-8,10-11H,2-5,9H2,1H3.
What are the key properties of 6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one?
6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one has a molecular weight of 347.87 g/mol, XLogP of 4.29, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-[(2-pentyl-1,3-thiazol-4-yl)methyl]quinazolin-4-one is sourced from PubChem (CID 154700574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).