C21H14FN3O3 — CID 154700855
N-(5-fluoropyrimidin-2-yl)-4-(4-methyl-2-oxochromen-7-yl)benzamide (PubChem CID 154700855) has the molecular formula C21H14FN3O3 and a molecular weight of 375.36 g/mol. Its IUPAC name is N-(5-fluoropyrimidin-2-yl)-4-(4-methyl-2-oxochromen-7-yl)benzamide.
| Compound Name | N-(5-fluoropyrimidin-2-yl)-4-(4-methyl-2-oxochromen-7-yl)benzamide |
|---|---|
| PubChem CID | 154700855 |
| Molecular Formula | C21H14FN3O3 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-(5-fluoropyrimidin-2-yl)-4-(4-methyl-2-oxochromen-7-yl)benzamide |
| SMILES | Cc1cc(=O)oc2cc(-c3ccc(C(=O)Nc4ncc(F)cn4)cc3)ccc12 |
| InChI | InChI=1S/C21H14FN3O3/c1-12-8-19(26)28-18-9-15(6-7-17(12)18)13-2-4-14(5-3-13)20(27)25-21-23-10-16(22)11-24-21/h2-11H,1H3,(H,23,24,25,27) |
| InChIKey | LHECPJFCJUFRKB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|