C8H15N3O3 — CID 154701034
8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrate (PubChem CID 154701034) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is 8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrate.
| Compound Name | 8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrate |
|---|---|
| PubChem CID | 154701034 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrate |
| SMILES | CN1CCC2(CC1)NC(=O)NC2=O.O |
| InChI | InChI=1S/C8H13N3O2.H2O/c1-11-4-2-8(3-5-11)6(12)9-7(13)10-8;/h2-5H2,1H3,(H2,9,10,12,13);1H2 |
| InChIKey | QYGOHJGCDCLLAQ-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|