About 6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine
6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine (PubChem CID 154701251) has the molecular formula C11H15N5
and a molecular weight of 217.28 g/mol. Its IUPAC name is 6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine |
| PubChem CID | 154701251 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine |
| SMILES | Cc1cc2c(ncn2C2(C)CNC2)c(N)n1 |
| InChI | InChI=1S/C11H15N5/c1-7-3-8-9(10(12)15-7)14-6-16(8)11(2)4-13-5-11/h3,6,13H,4-5H2,1-2H3,(H2,12,15) |
| InChIKey | PYKHQOYTMWANAP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine?
The IUPAC name of 6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine (CID 154701251) is 6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine.
What is the SMILES notation for 6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine?
The canonical SMILES for 6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine is Cc1cc2c(ncn2C2(C)CNC2)c(N)n1.
What is the InChIKey of 6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine?
The InChIKey is PYKHQOYTMWANAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5/c1-7-3-8-9(10(12)15-7)14-6-16(8)11(2)4-13-5-11/h3,6,13H,4-5H2,1-2H3,(H2,12,15).
What are the key properties of 6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine?
6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine has a molecular weight of 217.28 g/mol, XLogP of 0.64, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1-(3-methylazetidin-3-yl)imidazo[4,5-c]pyridin-4-amine is sourced from PubChem (CID 154701251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).