C23H26F2N8O3 — CID 154702420
6-amino-2-butoxy-9-[[6-[[6-[(2,2-difluoroethylamino)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one (PubChem CID 154702420) has the molecular formula C23H26F2N8O3 and a molecular weight of 500.51 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[[6-[[6-[(2,2-difluoroethylamino)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[[6-[[6-[(2,2-difluoroethylamino)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 154702420 |
| Molecular Formula | C23H26F2N8O3 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 6-amino-2-butoxy-9-[[6-[[6-[(2,2-difluoroethylamino)methyl]-3-pyridinyl]oxy]-3-pyridinyl]methyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(Oc4ccc(CNCC(F)F)nc4)nc3)c2n1 |
| InChI | InChI=1S/C23H26F2N8O3/c1-2-3-8-35-22-31-20(26)19-21(32-22)33(23(34)30-19)13-14-4-7-18(29-9-14)36-16-6-5-15(28-11-16)10-27-12-17(24)25/h4-7,9,11,17,27H,2-3,8,10,12-13H2,1H3,(H,30,34)(H2,26,31,32) |
| InChIKey | IRCRTVPRFIJIOL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|