C24H28F2N8O2 — CID 154702436
6-amino-2-butoxy-9-[[6-[4-[(2,2-difluoroethylamino)methyl]anilino]-3-pyridinyl]methyl]-7H-purin-8-one (PubChem CID 154702436) has the molecular formula C24H28F2N8O2 and a molecular weight of 498.54 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[[6-[4-[(2,2-difluoroethylamino)methyl]anilino]-3-pyridinyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[[6-[4-[(2,2-difluoroethylamino)methyl]anilino]-3-pyridinyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 154702436 |
| Molecular Formula | C24H28F2N8O2 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 6-amino-2-butoxy-9-[[6-[4-[(2,2-difluoroethylamino)methyl]anilino]-3-pyridinyl]methyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(Nc4ccc(CNCC(F)F)cc4)nc3)c2n1 |
| InChI | InChI=1S/C24H28F2N8O2/c1-2-3-10-36-23-32-21(27)20-22(33-23)34(24(35)31-20)14-16-6-9-19(29-12-16)30-17-7-4-15(5-8-17)11-28-13-18(25)26/h4-9,12,18,28H,2-3,10-11,13-14H2,1H3,(H,29,30)(H,31,35)(H2,27,32,33) |
| InChIKey | HDKNBSHKUGHLDM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 135.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|