C19H17N5 — CID 154702628
7-[(1R)-1,2-diphenylethyl]-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 154702628) has the molecular formula C19H17N5 and a molecular weight of 315.38 g/mol. Its IUPAC name is 7-[(1R)-1,2-diphenylethyl]-2H-triazolo[4,5-b]pyridin-5-amine.
| Compound Name | 7-[(1R)-1,2-diphenylethyl]-2H-triazolo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 154702628 |
| Molecular Formula | C19H17N5 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 7-[(1R)-1,2-diphenylethyl]-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | Nc1cc([C@H](Cc2ccccc2)c2ccccc2)c2n[nH]nc2n1 |
| InChI | InChI=1S/C19H17N5/c20-17-12-16(18-19(21-17)23-24-22-18)15(14-9-5-2-6-10-14)11-13-7-3-1-4-8-13/h1-10,12,15H,11H2,(H3,20,21,22,23,24)/t15-/m1/s1 |
| InChIKey | PCFOKFFOSYNQNP-OAHLLOKOSA-N |
| XLogP | 3.31 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |