C20H36O7 — CID 154702646
(3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-4,6,12-trihydroxy-9-(hydroxymethyl)-3,5,7,11,13,14-hexamethyl-oxacyclotetradecane-2,10-dione (PubChem CID 154702646) has the molecular formula C20H36O7 and a molecular weight of 388.50 g/mol. Its IUPAC name is (3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-4,6,12-trihydroxy-9-(hydroxymethyl)-3,5,7,11,13,14-hexamethyl-oxacyclotetradecane-2,10-dione.
| Compound Name | (3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-4,6,12-trihydroxy-9-(hydroxymethyl)-3,5,7,11,13,14-hexamethyl-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 154702646 |
| Molecular Formula | C20H36O7 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-4,6,12-trihydroxy-9-(hydroxymethyl)-3,5,7,11,13,14-hexamethyl-oxacyclotetradecane-2,10-dione |
| SMILES | C[C@@H]1[C@@H](O)[C@@H](C)C[C@H](CO)C(=O)[C@H](C)[C@@H](O)[C@@H](C)[C@@H](C)OC(=O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C20H36O7/c1-9-7-15(8-21)19(25)12(4)17(23)10(2)14(6)27-20(26)13(5)18(24)11(3)16(9)22/h9-18,21-24H,7-8H2,1-6H3/t9-,10-,11+,12+,13+,14+,15+,16-,17-,18-/m0/s1 |
| InChIKey | RKGUUSRWPBMVOT-FTBTZSRISA-N |
| XLogP | 0.76 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |