C39H30N6 — CID 154703059
4-[4-[4,6-bis[4-(4-aminophenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]aniline (PubChem CID 154703059) has the molecular formula C39H30N6 and a molecular weight of 582.71 g/mol. Its IUPAC name is 4-[4-[4,6-bis[4-(4-aminophenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]aniline.
| Compound Name | 4-[4-[4,6-bis[4-(4-aminophenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]aniline |
|---|---|
| PubChem CID | 154703059 |
| Molecular Formula | C39H30N6 |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | 4-[4-[4,6-bis[4-(4-aminophenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]aniline |
| SMILES | Nc1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccc(N)cc5)cc4)nc(-c4ccc(-c5ccc(N)cc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C39H30N6/c40-34-19-13-28(14-20-34)25-1-7-31(8-2-25)37-43-38(32-9-3-26(4-10-32)29-15-21-35(41)22-16-29)45-39(44-37)33-11-5-27(6-12-33)30-17-23-36(42)24-18-30/h1-24H,40-42H2 |
| InChIKey | YZHZLVSLFBPKBX-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|