C30H54O7SSi2 — CID 154703186
2-[(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-[(4-methylphenyl)sulfonylmethyl]oxolan-2-yl]acetaldehyde (PubChem CID 154703186) has the molecular formula C30H54O7SSi2 and a molecular weight of 614.99 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-[(4-methylphenyl)sulfonylmethyl]oxolan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-[(4-methylphenyl)sulfonylmethyl]oxolan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 154703186 |
| Molecular Formula | C30H54O7SSi2 |
| Molecular Weight | 614.99 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-[(4-methylphenyl)sulfonylmethyl]oxolan-2-yl]acetaldehyde |
| SMILES | CO[C@@H]1[C@@H](CS(=O)(=O)c2ccc(C)cc2)[C@H](CC=O)O[C@@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H54O7SSi2/c1-22-13-15-24(16-14-22)38(32,33)21-25-26(17-18-31)36-27(28(25)34-8)19-23(37-40(11,12)30(5,6)7)20-35-39(9,10)29(2,3)4/h13-16,18,23,25-28H,17,19-21H2,1-12H3/t23-,25-,26-,27+,28+/m0/s1 |
| InChIKey | KOLNCCOWEPGLNP-GRPMBEMWSA-N |
| XLogP | 6.56 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.99 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|