C20H15N7O — CID 154703643
3-[[4-[1-[2-(4-aminophenyl)ethynyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-yl]amino]propanenitrile (PubChem CID 154703643) has the molecular formula C20H15N7O and a molecular weight of 369.39 g/mol. Its IUPAC name is 3-[[4-[1-[2-(4-aminophenyl)ethynyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-yl]amino]propanenitrile.
| Compound Name | 3-[[4-[1-[2-(4-aminophenyl)ethynyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 154703643 |
| Molecular Formula | C20H15N7O |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3-[[4-[1-[2-(4-aminophenyl)ethynyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-yl]amino]propanenitrile |
| SMILES | N#CCCNc1nonc1-c1nc2ccccc2n1C#Cc1ccc(N)cc1 |
| InChI | InChI=1S/C20H15N7O/c21-11-3-12-23-19-18(25-28-26-19)20-24-16-4-1-2-5-17(16)27(20)13-10-14-6-8-15(22)9-7-14/h1-2,4-9H,3,12,22H2,(H,23,26) |
| InChIKey | FCWSQHGMHXGQFQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|